C10H16N2O2S — CID 151561633
tert-butyl N-(2-sulfanyl-2H-pyridin-1-yl)carbamate (PubChem CID 151561633) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is tert-butyl N-(2-sulfanyl-2H-pyridin-1-yl)carbamate.
| Compound Name | tert-butyl N-(2-sulfanyl-2H-pyridin-1-yl)carbamate |
|---|---|
| PubChem CID | 151561633 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | tert-butyl N-(2-sulfanyl-2H-pyridin-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN1C=CC=CC1S |
| InChI | InChI=1S/C10H16N2O2S/c1-10(2,3)14-9(13)11-12-7-5-4-6-8(12)15/h4-8,15H,1-3H3,(H,11,13) |
| InChIKey | QCOWCKFQUHBLRO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|