C22H19F3N6O — CID 151568940
1-[3-[[5-[2-[3-(trifluoromethyl)anilino]pyrimidin-5-yl]-3-pyridinyl]amino]azetidin-1-yl]prop-2-en-1-one (PubChem CID 151568940) has the molecular formula C22H19F3N6O and a molecular weight of 440.43 g/mol. Its IUPAC name is 1-[3-[[5-[2-[3-(trifluoromethyl)anilino]pyrimidin-5-yl]-3-pyridinyl]amino]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[5-[2-[3-(trifluoromethyl)anilino]pyrimidin-5-yl]-3-pyridinyl]amino]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 151568940 |
| Molecular Formula | C22H19F3N6O |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[3-[[5-[2-[3-(trifluoromethyl)anilino]pyrimidin-5-yl]-3-pyridinyl]amino]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(Nc2cncc(-c3cnc(Nc4cccc(C(F)(F)F)c4)nc3)c2)C1 |
| InChI | InChI=1S/C22H19F3N6O/c1-2-20(32)31-12-19(13-31)29-18-6-14(8-26-11-18)15-9-27-21(28-10-15)30-17-5-3-4-16(7-17)22(23,24)25/h2-11,19,29H,1,12-13H2,(H,27,28,30) |
| InChIKey | QEAKGLKCIUKCNZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|