C20H19F3N2O — CID 56580901
(E)-1-(3-anilinopyrrolidin-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 56580901) has the molecular formula C20H19F3N2O and a molecular weight of 360.38 g/mol. Its IUPAC name is (E)-1-(3-anilinopyrrolidin-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3-anilinopyrrolidin-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56580901 |
| Molecular Formula | C20H19F3N2O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (E)-1-(3-anilinopyrrolidin-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)N1CCC(Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H19F3N2O/c21-20(22,23)16-6-4-5-15(13-16)9-10-19(26)25-12-11-18(14-25)24-17-7-2-1-3-8-17/h1-10,13,18,24H,11-12,14H2/b10-9+ |
| InChIKey | IDJFGNFKKPOHSU-MDZDMXLPSA-N |
| XLogP | 4.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|