C25H29F2N3O2Si — CID 151573594
(1R)-6-cyano-N-(3,5-difluoro-4-trimethylsilylphenyl)-2-pentanoyl-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 151573594) has the molecular formula C25H29F2N3O2Si and a molecular weight of 469.61 g/mol. Its IUPAC name is (1R)-6-cyano-N-(3,5-difluoro-4-trimethylsilylphenyl)-2-pentanoyl-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | (1R)-6-cyano-N-(3,5-difluoro-4-trimethylsilylphenyl)-2-pentanoyl-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 151573594 |
| Molecular Formula | C25H29F2N3O2Si |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (1R)-6-cyano-N-(3,5-difluoro-4-trimethylsilylphenyl)-2-pentanoyl-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | CCCCC(=O)N1CCc2cc(C#N)ccc2[C@@H]1C(=O)Nc1cc(F)c([Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C25H29F2N3O2Si/c1-5-6-7-22(31)30-11-10-17-12-16(15-28)8-9-19(17)23(30)25(32)29-18-13-20(26)24(21(27)14-18)33(2,3)4/h8-9,12-14,23H,5-7,10-11H2,1-4H3,(H,29,32)/t23-/m1/s1 |
| InChIKey | QEYWYHJCIDCDAK-HSZRJFAPSA-N |
| XLogP | 4.64 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|