C13H13N3O6S — CID 151574030
[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl] methanesulfonate (PubChem CID 151574030) has the molecular formula C13H13N3O6S and a molecular weight of 339.33 g/mol. Its IUPAC name is [3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl] methanesulfonate.
| Compound Name | [3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 151574030 |
| Molecular Formula | C13H13N3O6S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl] methanesulfonate |
| SMILES | Cc1nc(-c2ccc(N3CC(OS(C)(=O)=O)OC3=O)cc2)no1 |
| InChI | InChI=1S/C13H13N3O6S/c1-8-14-12(15-21-8)9-3-5-10(6-4-9)16-7-11(20-13(16)17)22-23(2,18)19/h3-6,11H,7H2,1-2H3 |
| InChIKey | QFBCOACBHNMNAP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 111.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|