C19H18ClN5O7S — CID 139910192
5-chloro-N-[[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-nitrocyclohexa-1,3-diene-1-sulfonamide (PubChem CID 139910192) has the molecular formula C19H18ClN5O7S and a molecular weight of 495.90 g/mol. Its IUPAC name is 5-chloro-N-[[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-nitrocyclohexa-1,3-diene-1-sulfonamide.
| Compound Name | 5-chloro-N-[[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-nitrocyclohexa-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 139910192 |
| Molecular Formula | C19H18ClN5O7S |
| Molecular Weight | 495.90 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 5-chloro-N-[[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-5-nitrocyclohexa-1,3-diene-1-sulfonamide |
| SMILES | Cc1nc(-c2ccc(N3CC(CNS(=O)(=O)C4=CC=CC(Cl)([N+](=O)[O-])C4)OC3=O)cc2)no1 |
| InChI | InChI=1S/C19H18ClN5O7S/c1-12-22-17(23-32-12)13-4-6-14(7-5-13)24-11-15(31-18(24)26)10-21-33(29,30)16-3-2-8-19(20,9-16)25(27)28/h2-8,15,21H,9-11H2,1H3 |
| InChIKey | ZIEIVWSFFAORJI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.90 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|