C24H24N6O6 — CID 54318818
3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[[4-(3-nitrobenzoyl)piperazin-1-yl]methyl]-1,3-oxazolidin-2-one (PubChem CID 54318818) has the molecular formula C24H24N6O6 and a molecular weight of 492.49 g/mol. Its IUPAC name is 3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[[4-(3-nitrobenzoyl)piperazin-1-yl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[[4-(3-nitrobenzoyl)piperazin-1-yl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54318818 |
| Molecular Formula | C24H24N6O6 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-[[4-(3-nitrobenzoyl)piperazin-1-yl]methyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1nc(-c2ccc(N3CC(CN4CCN(C(=O)c5cccc([N+](=O)[O-])c5)CC4)OC3=O)cc2)no1 |
| InChI | InChI=1S/C24H24N6O6/c1-16-25-22(26-36-16)17-5-7-19(8-6-17)29-15-21(35-24(29)32)14-27-9-11-28(12-10-27)23(31)18-3-2-4-20(13-18)30(33)34/h2-8,13,21H,9-12,14-15H2,1H3 |
| InChIKey | SQDOGXUHOSFCEO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 135.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|