C24H24FN7O6 — CID 10301822
N-(4-fluoro-3-nitrophenyl)-4-[[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazine-1-carboxamide (PubChem CID 10301822) has the molecular formula C24H24FN7O6 and a molecular weight of 525.50 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-4-[[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazine-1-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-4-[[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 10301822 |
| Molecular Formula | C24H24FN7O6 |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-4-[[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]piperazine-1-carboxamide |
| SMILES | Cc1nc(-c2ccc(N3CC(CN4CCN(C(=O)Nc5ccc(F)c([N+](=O)[O-])c5)CC4)OC3=O)cc2)no1 |
| InChI | InChI=1S/C24H24FN7O6/c1-15-26-22(28-38-15)16-2-5-18(6-3-16)31-14-19(37-24(31)34)13-29-8-10-30(11-9-29)23(33)27-17-4-7-20(25)21(12-17)32(35)36/h2-7,12,19H,8-11,13-14H2,1H3,(H,27,33) |
| InChIKey | SCYBGTQFMQAOPR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 147.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|