C22H23ClFN3O2 — CID 151577832
1-butyl-3-(3-chloro-4-fluorophenyl)-1-[(1S)-1-(1-oxo-2H-isoquinolin-4-yl)ethyl]urea (PubChem CID 151577832) has the molecular formula C22H23ClFN3O2 and a molecular weight of 415.90 g/mol. Its IUPAC name is 1-butyl-3-(3-chloro-4-fluorophenyl)-1-[(1S)-1-(1-oxo-2H-isoquinolin-4-yl)ethyl]urea.
| Compound Name | 1-butyl-3-(3-chloro-4-fluorophenyl)-1-[(1S)-1-(1-oxo-2H-isoquinolin-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 151577832 |
| Molecular Formula | C22H23ClFN3O2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-butyl-3-(3-chloro-4-fluorophenyl)-1-[(1S)-1-(1-oxo-2H-isoquinolin-4-yl)ethyl]urea |
| SMILES | CCCCN(C(=O)Nc1ccc(F)c(Cl)c1)[C@@H](C)c1c[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H23ClFN3O2/c1-3-4-11-27(22(29)26-15-9-10-20(24)19(23)12-15)14(2)18-13-25-21(28)17-8-6-5-7-16(17)18/h5-10,12-14H,3-4,11H2,1-2H3,(H,25,28)(H,26,29)/t14-/m0/s1 |
| InChIKey | QFVKRILSYQEKIQ-AWEZNQCLSA-N |
| XLogP | 5.72 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |