C20H22ClFN4O3 — CID 167341677
4-[1-[[(3-chloro-4-fluoroanilino)-hydroxymethyl]-(3-hydroxypropyl)amino]ethyl]-2H-2,7-naphthyridin-1-one (PubChem CID 167341677) has the molecular formula C20H22ClFN4O3 and a molecular weight of 420.87 g/mol. Its IUPAC name is 4-[1-[[(3-chloro-4-fluoroanilino)-hydroxymethyl]-(3-hydroxypropyl)amino]ethyl]-2H-2,7-naphthyridin-1-one.
| Compound Name | 4-[1-[[(3-chloro-4-fluoroanilino)-hydroxymethyl]-(3-hydroxypropyl)amino]ethyl]-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 167341677 |
| Molecular Formula | C20H22ClFN4O3 |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-[1-[[(3-chloro-4-fluoroanilino)-hydroxymethyl]-(3-hydroxypropyl)amino]ethyl]-2H-2,7-naphthyridin-1-one |
| SMILES | CC(c1c[nH]c(=O)c2cnccc12)N(CCCO)C(O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClFN4O3/c1-12(15-11-24-19(28)16-10-23-6-5-14(15)16)26(7-2-8-27)20(29)25-13-3-4-18(22)17(21)9-13/h3-6,9-12,20,25,27,29H,2,7-8H2,1H3,(H,24,28) |
| InChIKey | QMKAKJKTOODGFU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|