C13H14F3NO5S — CID 15158314
2-[2-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-5-yl]ethyl methanesulfonate (PubChem CID 15158314) has the molecular formula C13H14F3NO5S and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-[2-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-5-yl]ethyl methanesulfonate.
| Compound Name | 2-[2-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-5-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 15158314 |
| Molecular Formula | C13H14F3NO5S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-[2-oxo-3-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-5-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC1CN(c2cccc(C(F)(F)F)c2)C(=O)O1 |
| InChI | InChI=1S/C13H14F3NO5S/c1-23(19,20)21-6-5-11-8-17(12(18)22-11)10-4-2-3-9(7-10)13(14,15)16/h2-4,7,11H,5-6,8H2,1H3 |
| InChIKey | XWOVBGPAOUXSQS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|