C54H50O2 — CID 151591558
4,6-bis[2-[(4-tert-butylphenyl)methyl]-9H-fluoren-1-yl]benzene-1,3-diol (PubChem CID 151591558) has the molecular formula C54H50O2 and a molecular weight of 730.99 g/mol. Its IUPAC name is 4,6-bis[2-[(4-tert-butylphenyl)methyl]-9H-fluoren-1-yl]benzene-1,3-diol.
| Compound Name | 4,6-bis[2-[(4-tert-butylphenyl)methyl]-9H-fluoren-1-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 151591558 |
| Molecular Formula | C54H50O2 |
| Molecular Weight | 730.99 g/mol |
| Exact Mass | 730.38 |
| IUPAC Name | 4,6-bis[2-[(4-tert-butylphenyl)methyl]-9H-fluoren-1-yl]benzene-1,3-diol |
| SMILES | CC(C)(C)c1ccc(Cc2ccc3c(c2-c2cc(-c4c(Cc5ccc(C(C)(C)C)cc5)ccc5c4Cc4ccccc4-5)c(O)cc2O)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C54H50O2/c1-53(2,3)39-21-15-33(16-22-39)27-37-19-25-43-41-13-9-7-11-35(41)29-45(43)51(37)47-31-48(50(56)32-49(47)55)52-38(28-34-17-23-40(24-18-34)54(4,5)6)20-26-44-42-14-10-8-12-36(42)30-46(44)52/h7-26,31-32,55-56H,27-30H2,1-6H3 |
| InChIKey | QIPMICHBFQZHJO-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.99 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |