C24H25ClN2 — CID 151599273
1-[1-chloro-2-(4-ethynylphenyl)cyclohexa-2,4-dien-1-yl]-5-(1-methylpyrrolidin-2-yl)-2H-pyridine (PubChem CID 151599273) has the molecular formula C24H25ClN2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 1-[1-chloro-2-(4-ethynylphenyl)cyclohexa-2,4-dien-1-yl]-5-(1-methylpyrrolidin-2-yl)-2H-pyridine.
| Compound Name | 1-[1-chloro-2-(4-ethynylphenyl)cyclohexa-2,4-dien-1-yl]-5-(1-methylpyrrolidin-2-yl)-2H-pyridine |
|---|---|
| PubChem CID | 151599273 |
| Molecular Formula | C24H25ClN2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-[1-chloro-2-(4-ethynylphenyl)cyclohexa-2,4-dien-1-yl]-5-(1-methylpyrrolidin-2-yl)-2H-pyridine |
| SMILES | C#Cc1ccc(C2=CC=CCC2(Cl)N2C=C(C3CCCN3C)C=CC2)cc1 |
| InChI | InChI=1S/C24H25ClN2/c1-3-19-11-13-20(14-12-19)22-9-4-5-15-24(22,25)27-17-6-8-21(18-27)23-10-7-16-26(23)2/h1,4-6,8-9,11-14,18,23H,7,10,15-17H2,2H3 |
| InChIKey | QKDGMGLDBXYWQR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|