C13H18N2 — CID 67649270
5-(1-methylpyrrolidin-2-yl)-1-prop-1-ynyl-2H-pyridine (PubChem CID 67649270) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-(1-methylpyrrolidin-2-yl)-1-prop-1-ynyl-2H-pyridine.
| Compound Name | 5-(1-methylpyrrolidin-2-yl)-1-prop-1-ynyl-2H-pyridine |
|---|---|
| PubChem CID | 67649270 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 5-(1-methylpyrrolidin-2-yl)-1-prop-1-ynyl-2H-pyridine |
| SMILES | CC#CN1C=C(C2CCCN2C)C=CC1 |
| InChI | InChI=1S/C13H18N2/c1-3-8-15-10-4-6-12(11-15)13-7-5-9-14(13)2/h4,6,11,13H,5,7,9-10H2,1-2H3 |
| InChIKey | LSUBCZFICWLSBD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|