C10H16N2 — CID 45088833
3-[(2S)-1-methylpyrrolidin-2-yl]-1,4-dihydropyridine (PubChem CID 45088833) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 3-[(2S)-1-methylpyrrolidin-2-yl]-1,4-dihydropyridine.
| Compound Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-1,4-dihydropyridine |
|---|---|
| PubChem CID | 45088833 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 3-[(2S)-1-methylpyrrolidin-2-yl]-1,4-dihydropyridine |
| SMILES | CN1CCC[C@H]1C1=CNC=CC1 |
| InChI | InChI=1S/C10H16N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,6,8,10-11H,3-5,7H2,1H3/t10-/m0/s1 |
| InChIKey | YKFPBHYPTBLDNN-JTQLQIEISA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |