C20H41NO2 — CID 151601533
(Z,7R)-18-(2-hydroxyethylamino)octadec-9-en-7-ol (PubChem CID 151601533) has the molecular formula C20H41NO2 and a molecular weight of 327.55 g/mol. Its IUPAC name is (Z,7R)-18-(2-hydroxyethylamino)octadec-9-en-7-ol.
| Compound Name | (Z,7R)-18-(2-hydroxyethylamino)octadec-9-en-7-ol |
|---|---|
| PubChem CID | 151601533 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | (Z,7R)-18-(2-hydroxyethylamino)octadec-9-en-7-ol |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCCNCCO |
| InChI | InChI=1S/C20H41NO2/c1-2-3-4-12-15-20(23)16-13-10-8-6-5-7-9-11-14-17-21-18-19-22/h10,13,20-23H,2-9,11-12,14-19H2,1H3/b13-10-/t20-/m1/s1 |
| InChIKey | SUPFOMMAVDPYLP-KTZABMDBSA-N |
| XLogP | 4.58 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|