C40H47N5O7 — CID 15160766
methyl 12-(2-acetamidoethyl)-7-ethyl-18,20-bis(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-carboxylate (PubChem CID 15160766) has the molecular formula C40H47N5O7 and a molecular weight of 709.84 g/mol. Its IUPAC name is methyl 12-(2-acetamidoethyl)-7-ethyl-18,20-bis(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-carboxylate.
| Compound Name | methyl 12-(2-acetamidoethyl)-7-ethyl-18,20-bis(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 15160766 |
| Molecular Formula | C40H47N5O7 |
| Molecular Weight | 709.84 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | methyl 12-(2-acetamidoethyl)-7-ethyl-18,20-bis(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-carboxylate |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(CCC(=O)OC)c5nc(cc1[nH]2)C(C)=C5C(=O)OC)C(CCC(=O)OC)=C4C)c(C)c3CCNC(C)=O |
| InChI | InChI=1S/C40H47N5O7/c1-10-25-20(2)30-18-34-26(15-16-41-24(6)46)21(3)29(43-34)17-31-22(4)27(11-13-35(47)50-7)38(44-31)28(12-14-36(48)51-8)39-37(40(49)52-9)23(5)32(45-39)19-33(25)42-30/h17-19,42-43H,10-16H2,1-9H3,(H,41,46)/b29-17-,30-18-,31-17-,32-19-,33-19-,34-18-,38-28-,39-28- |
| InChIKey | XMLASHYMIQKPGX-RZIAWZSXSA-N |
| XLogP | 6.27 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.84 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|