C14H10N2O2S — CID 151608882
5-pyridin-3-yl-1λ6,4-benzothiazepine 1,1-dioxide (PubChem CID 151608882) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is 5-pyridin-3-yl-1λ6,4-benzothiazepine 1,1-dioxide.
| Compound Name | 5-pyridin-3-yl-1λ6,4-benzothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 151608882 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 5-pyridin-3-yl-1λ6,4-benzothiazepine 1,1-dioxide |
| SMILES | O=S1(=O)C=CN=C(c2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C14H10N2O2S/c17-19(18)9-8-16-14(11-4-3-7-15-10-11)12-5-1-2-6-13(12)19/h1-10H |
| InChIKey | QMBKSKQRGRYKIA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |