C18H11NO3S — CID 11493501
10,10-dioxo-3-pyridin-3-ylthioxanthen-9-one (PubChem CID 11493501) has the molecular formula C18H11NO3S and a molecular weight of 321.36 g/mol. Its IUPAC name is 10,10-dioxo-3-pyridin-3-ylthioxanthen-9-one.
| Compound Name | 10,10-dioxo-3-pyridin-3-ylthioxanthen-9-one |
|---|---|
| PubChem CID | 11493501 |
| Molecular Formula | C18H11NO3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 10,10-dioxo-3-pyridin-3-ylthioxanthen-9-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)c2cc(-c3cccnc3)ccc21 |
| InChI | InChI=1S/C18H11NO3S/c20-18-14-5-1-2-6-16(14)23(21,22)17-10-12(7-8-15(17)18)13-4-3-9-19-11-13/h1-11H |
| InChIKey | IEANRSKCKGURHE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |