C17H16ClF3N2OS — CID 151615920
2-amino-3-[(5-chloro-2-ethylsulfanylphenyl)methyl]-5-(trifluoromethyl)benzamide (PubChem CID 151615920) has the molecular formula C17H16ClF3N2OS and a molecular weight of 388.84 g/mol. Its IUPAC name is 2-amino-3-[(5-chloro-2-ethylsulfanylphenyl)methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-3-[(5-chloro-2-ethylsulfanylphenyl)methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 151615920 |
| Molecular Formula | C17H16ClF3N2OS |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-amino-3-[(5-chloro-2-ethylsulfanylphenyl)methyl]-5-(trifluoromethyl)benzamide |
| SMILES | CCSc1ccc(Cl)cc1Cc1cc(C(F)(F)F)cc(C(N)=O)c1N |
| InChI | InChI=1S/C17H16ClF3N2OS/c1-2-25-14-4-3-12(18)7-9(14)5-10-6-11(17(19,20)21)8-13(15(10)22)16(23)24/h3-4,6-8H,2,5,22H2,1H3,(H2,23,24) |
| InChIKey | VYYFSBPSXDARLJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|