C22H46O5Si2 — CID 15161682
tert-butyl (3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate (PubChem CID 15161682) has the molecular formula C22H46O5Si2 and a molecular weight of 446.78 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate.
| Compound Name | tert-butyl (3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate |
|---|---|
| PubChem CID | 15161682 |
| Molecular Formula | C22H46O5Si2 |
| Molecular Weight | 446.78 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | tert-butyl (3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C[C@@H](C=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O5Si2/c1-20(2,3)25-19(24)15-17(26-28(10,11)21(4,5)6)14-18(16-23)27-29(12,13)22(7,8)9/h16-18H,14-15H2,1-13H3/t17-,18+/m1/s1 |
| InChIKey | MULCPKSIRWDCJV-MSOLQXFVSA-N |
| XLogP | 6.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.78 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|