C37H72O6P+ — CID 151620697
oxo-prop-2-enoyl-(1,2,2,2-tetraoctoxyethyl)phosphanium (PubChem CID 151620697) has the molecular formula C37H72O6P+ and a molecular weight of 643.95 g/mol. Its IUPAC name is oxo-prop-2-enoyl-(1,2,2,2-tetraoctoxyethyl)phosphanium.
| Compound Name | oxo-prop-2-enoyl-(1,2,2,2-tetraoctoxyethyl)phosphanium |
|---|---|
| PubChem CID | 151620697 |
| Molecular Formula | C37H72O6P+ |
| Molecular Weight | 643.95 g/mol |
| Exact Mass | 643.51 |
| IUPAC Name | oxo-prop-2-enoyl-(1,2,2,2-tetraoctoxyethyl)phosphanium |
| SMILES | C=CC(=O)[P+](=O)C(OCCCCCCCC)C(OCCCCCCCC)(OCCCCCCCC)OCCCCCCCC |
| InChI | InChI=1S/C37H72O6P/c1-6-11-15-19-23-27-31-40-36(44(39)35(38)10-5)37(41-32-28-24-20-16-12-7-2,42-33-29-25-21-17-13-8-3)43-34-30-26-22-18-14-9-4/h10,36H,5-9,11-34H2,1-4H3/q+1 |
| InChIKey | JNQKTYKGBZUAPT-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.95 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|