C41H80O7P+ — CID 150185956
oxo-(1,1,3,3,3-pentaheptoxypropyl)-prop-2-enoylphosphanium (PubChem CID 150185956) has the molecular formula C41H80O7P+ and a molecular weight of 716.06 g/mol. Its IUPAC name is oxo-(1,1,3,3,3-pentaheptoxypropyl)-prop-2-enoylphosphanium.
| Compound Name | oxo-(1,1,3,3,3-pentaheptoxypropyl)-prop-2-enoylphosphanium |
|---|---|
| PubChem CID | 150185956 |
| Molecular Formula | C41H80O7P+ |
| Molecular Weight | 716.06 g/mol |
| Exact Mass | 715.56 |
| IUPAC Name | oxo-(1,1,3,3,3-pentaheptoxypropyl)-prop-2-enoylphosphanium |
| SMILES | C=CC(=O)[P+](=O)C(CC(OCCCCCCC)(OCCCCCCC)OCCCCCCC)(OCCCCCCC)OCCCCCCC |
| InChI | InChI=1S/C41H80O7P/c1-7-13-18-23-28-33-44-40(45-34-29-24-19-14-8-2,46-35-30-25-20-15-9-3)38-41(49(43)39(42)12-6,47-36-31-26-21-16-10-4)48-37-32-27-22-17-11-5/h12H,6-11,13-38H2,1-5H3/q+1 |
| InChIKey | KSIWGIQZQAYFQQ-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.06 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|