C16H30O7P+ — CID 150767688
oxo-(1,1,3,3,3-pentaethoxypropyl)-prop-2-enoylphosphanium (PubChem CID 150767688) has the molecular formula C16H30O7P+ and a molecular weight of 365.38 g/mol. Its IUPAC name is oxo-(1,1,3,3,3-pentaethoxypropyl)-prop-2-enoylphosphanium.
| Compound Name | oxo-(1,1,3,3,3-pentaethoxypropyl)-prop-2-enoylphosphanium |
|---|---|
| PubChem CID | 150767688 |
| Molecular Formula | C16H30O7P+ |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | oxo-(1,1,3,3,3-pentaethoxypropyl)-prop-2-enoylphosphanium |
| SMILES | C=CC(=O)[P+](=O)C(CC(OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C16H30O7P/c1-7-14(17)24(18)16(22-11-5,23-12-6)13-15(19-8-2,20-9-3)21-10-4/h7H,1,8-13H2,2-6H3/q+1 |
| InChIKey | OWHGLWJZDRHXDE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|