C32H40N2O6S — CID 15163128
N-methyl-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]propan-1-amine (PubChem CID 15163128) has the molecular formula C32H40N2O6S and a molecular weight of 580.75 g/mol. Its IUPAC name is N-methyl-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]propan-1-amine.
| Compound Name | N-methyl-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 15163128 |
| Molecular Formula | C32H40N2O6S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | N-methyl-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]-N-[2-(3,4,5-trimethoxyphenyl)ethyl]propan-1-amine |
| SMILES | COc1cc(CCN(C)CCCOc2ccc(S(=O)(=O)c3c(C(C)C)cn4ccccc34)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C32H40N2O6S/c1-23(2)27-22-34-17-8-7-10-28(34)32(27)41(35,36)26-13-11-25(12-14-26)40-19-9-16-33(3)18-15-24-20-29(37-4)31(39-6)30(21-24)38-5/h7-8,10-14,17,20-23H,9,15-16,18-19H2,1-6H3 |
| InChIKey | GJEPQFFTPWRSOJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|