About [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate
[7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate (PubChem CID 151633631) has the molecular formula C25H21N3O6
and a molecular weight of 459.46 g/mol. Its IUPAC name is [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate.
Molecular Properties
| Compound Name | [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate |
| PubChem CID | 151633631 |
| Molecular Formula | C25H21N3O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate |
| SMILES | COc1cc(C(=O)c2c(C)c(OC(=O)Cc3ccccc3)c3cc(N)ccn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21N3O6/c1-15-23(24(30)17-8-9-19(28(31)32)21(13-17)33-2)27-11-10-18(26)14-20(27)25(15)34-22(29)12-16-6-4-3-5-7-16/h3-11,13-14H,12,26H2,1-2H3 |
| InChIKey | QRARYCFRLMZALF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate?
The IUPAC name of [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate (CID 151633631) is [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate.
What is the SMILES notation for [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate?
The canonical SMILES for [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate is COc1cc(C(=O)c2c(C)c(OC(=O)Cc3ccccc3)c3cc(N)ccn23)ccc1[N+](=O)[O-].
What is the InChIKey of [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate?
The InChIKey is QRARYCFRLMZALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O6/c1-15-23(24(30)17-8-9-19(28(31)32)21(13-17)33-2)27-11-10-18(26)14-20(27)25(15)34-22(29)12-16-6-4-3-5-7-16/h3-11,13-14H,12,26H2,1-2H3.
What are the key properties of [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate?
[7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate has a molecular weight of 459.46 g/mol, XLogP of 4.13, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [7-amino-3-(3-methoxy-4-nitrobenzoyl)-2-methylindolizin-1-yl] 2-phenylacetate is sourced from PubChem (CID 151633631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).