About (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone
(1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone (PubChem CID 69418644) has the molecular formula C16H14N4O4
and a molecular weight of 326.31 g/mol. Its IUPAC name is (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone.
Molecular Properties
| Compound Name | (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone |
| PubChem CID | 69418644 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone |
| SMILES | CCOc1cc(C(=O)c2nc(N)c3ccccn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N4O4/c1-2-24-13-9-10(6-7-11(13)20(22)23)14(21)16-18-15(17)12-5-3-4-8-19(12)16/h3-9H,2,17H2,1H3 |
| InChIKey | IMJABTCHQLILIM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone?
The IUPAC name of (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone (CID 69418644) is (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone.
What is the SMILES notation for (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone?
The canonical SMILES for (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone is CCOc1cc(C(=O)c2nc(N)c3ccccn23)ccc1[N+](=O)[O-].
What is the InChIKey of (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone?
The InChIKey is IMJABTCHQLILIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O4/c1-2-24-13-9-10(6-7-11(13)20(22)23)14(21)16-18-15(17)12-5-3-4-8-19(12)16/h3-9H,2,17H2,1H3.
What are the key properties of (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone?
(1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone has a molecular weight of 326.31 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminoimidazo[1,5-a]pyridin-3-yl)-(3-ethoxy-4-nitrophenyl)methanone is sourced from PubChem (CID 69418644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).