C8H5NO4 — CID 151661649
1,2,3-benzodioxazine-4-carboxylic acid (PubChem CID 151661649) has the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. Its IUPAC name is 1,2,3-benzodioxazine-4-carboxylic acid.
| Compound Name | 1,2,3-benzodioxazine-4-carboxylic acid |
|---|---|
| PubChem CID | 151661649 |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 1,2,3-benzodioxazine-4-carboxylic acid |
| SMILES | O=C(O)C1=NOOc2ccccc21 |
| InChI | InChI=1S/C8H5NO4/c10-8(11)7-5-3-1-2-4-6(5)12-13-9-7/h1-4H,(H,10,11) |
| InChIKey | QWQWLMQHQPVMMS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|