About 1-(1H-inden-1-yl)azepane
1-(1H-inden-1-yl)azepane (PubChem CID 151689000) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(1H-inden-1-yl)azepane.
Molecular Properties
| Compound Name | 1-(1H-inden-1-yl)azepane |
| PubChem CID | 151689000 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1-(1H-inden-1-yl)azepane |
| SMILES | C1=CC(N2CCCCCC2)c2ccccc21 |
| InChI | InChI=1S/C15H19N/c1-2-6-12-16(11-5-1)15-10-9-13-7-3-4-8-14(13)15/h3-4,7-10,15H,1-2,5-6,11-12H2 |
| InChIKey | RCDQMNZSRIXPPN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1H-inden-1-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-inden-1-yl)azepane?
The IUPAC name of 1-(1H-inden-1-yl)azepane (CID 151689000) is 1-(1H-inden-1-yl)azepane.
What is the SMILES notation for 1-(1H-inden-1-yl)azepane?
The canonical SMILES for 1-(1H-inden-1-yl)azepane is C1=CC(N2CCCCCC2)c2ccccc21.
What is the InChIKey of 1-(1H-inden-1-yl)azepane?
The InChIKey is RCDQMNZSRIXPPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N/c1-2-6-12-16(11-5-1)15-10-9-13-7-3-4-8-14(13)15/h3-4,7-10,15H,1-2,5-6,11-12H2.
What are the key properties of 1-(1H-inden-1-yl)azepane?
1-(1H-inden-1-yl)azepane has a molecular weight of 213.32 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-inden-1-yl)azepane is sourced from PubChem (CID 151689000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).