C16H19NO4 — CID 151689388
2-cyano-3,3-diethyl-2-phenylpentanedioic acid (PubChem CID 151689388) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-cyano-3,3-diethyl-2-phenylpentanedioic acid.
| Compound Name | 2-cyano-3,3-diethyl-2-phenylpentanedioic acid |
|---|---|
| PubChem CID | 151689388 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-cyano-3,3-diethyl-2-phenylpentanedioic acid |
| SMILES | CCC(CC)(CC(=O)O)C(C#N)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO4/c1-3-15(4-2,10-13(18)19)16(11-17,14(20)21)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | RCFQUWKKQIWBFK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |