C12H11N3O — CID 19919955
2,2-dicyano-N,N-dimethyl-2-phenylacetamide (PubChem CID 19919955) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 2,2-dicyano-N,N-dimethyl-2-phenylacetamide.
| Compound Name | 2,2-dicyano-N,N-dimethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 19919955 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2,2-dicyano-N,N-dimethyl-2-phenylacetamide |
| SMILES | CN(C)C(=O)C(C#N)(C#N)c1ccccc1 |
| InChI | InChI=1S/C12H11N3O/c1-15(2)11(16)12(8-13,9-14)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | OTPPMYWQYSVEOR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |