C23H28N2O — CID 101165082
(3R,4R)-4-cyano-N,N-dimethyl-3,4-diphenyloctanamide (PubChem CID 101165082) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (3R,4R)-4-cyano-N,N-dimethyl-3,4-diphenyloctanamide.
| Compound Name | (3R,4R)-4-cyano-N,N-dimethyl-3,4-diphenyloctanamide |
|---|---|
| PubChem CID | 101165082 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (3R,4R)-4-cyano-N,N-dimethyl-3,4-diphenyloctanamide |
| SMILES | CCCC[C@](C#N)(c1ccccc1)[C@H](CC(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O/c1-4-5-16-23(18-24,20-14-10-7-11-15-20)21(17-22(26)25(2)3)19-12-8-6-9-13-19/h6-15,21H,4-5,16-17H2,1-3H3/t21-,23+/m1/s1 |
| InChIKey | JJMPNCIOYAVRJA-GGAORHGYSA-N |
| XLogP | 4.90 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |