C22H24N2O3 — CID 101165086
[(2S,3R)-2-cyano-5-(dimethylamino)-5-oxo-2,3-diphenylpentyl] acetate (PubChem CID 101165086) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is [(2S,3R)-2-cyano-5-(dimethylamino)-5-oxo-2,3-diphenylpentyl] acetate.
| Compound Name | [(2S,3R)-2-cyano-5-(dimethylamino)-5-oxo-2,3-diphenylpentyl] acetate |
|---|---|
| PubChem CID | 101165086 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [(2S,3R)-2-cyano-5-(dimethylamino)-5-oxo-2,3-diphenylpentyl] acetate |
| SMILES | CC(=O)OC[C@](C#N)(c1ccccc1)[C@H](CC(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c1-17(25)27-16-22(15-23,19-12-8-5-9-13-19)20(14-21(26)24(2)3)18-10-6-4-7-11-18/h4-13,20H,14,16H2,1-3H3/t20-,22-/m1/s1 |
| InChIKey | SCRFZJOPYXWSQP-IFMALSPDSA-N |
| XLogP | 3.27 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |