C24H30N2O2 — CID 101165091
(2R,3R)-N,N,N',N'-tetramethyl-2,3-diphenyl-2-prop-2-enylpentanediamide (PubChem CID 101165091) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (2R,3R)-N,N,N',N'-tetramethyl-2,3-diphenyl-2-prop-2-enylpentanediamide.
| Compound Name | (2R,3R)-N,N,N',N'-tetramethyl-2,3-diphenyl-2-prop-2-enylpentanediamide |
|---|---|
| PubChem CID | 101165091 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (2R,3R)-N,N,N',N'-tetramethyl-2,3-diphenyl-2-prop-2-enylpentanediamide |
| SMILES | C=CC[C@](C(=O)N(C)C)(c1ccccc1)[C@H](CC(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O2/c1-6-17-24(23(28)26(4)5,20-15-11-8-12-16-20)21(18-22(27)25(2)3)19-13-9-7-10-14-19/h6-16,21H,1,17-18H2,2-5H3/t21-,24+/m1/s1 |
| InChIKey | OILIVEUFFPQAMI-QPPBQGQZSA-N |
| XLogP | 3.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|