C21H18N2O — CID 102400621
2-(3-oxo-1,3-diphenylpropyl)-2-prop-2-enylpropanedinitrile (PubChem CID 102400621) has the molecular formula C21H18N2O and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(3-oxo-1,3-diphenylpropyl)-2-prop-2-enylpropanedinitrile.
| Compound Name | 2-(3-oxo-1,3-diphenylpropyl)-2-prop-2-enylpropanedinitrile |
|---|---|
| PubChem CID | 102400621 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(3-oxo-1,3-diphenylpropyl)-2-prop-2-enylpropanedinitrile |
| SMILES | C=CCC(C#N)(C#N)C(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O/c1-2-13-21(15-22,16-23)19(17-9-5-3-6-10-17)14-20(24)18-11-7-4-8-12-18/h2-12,19H,1,13-14H2 |
| InChIKey | QZLRQLNNNZTVOP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|