C23H17Cl2NO — CID 980020
(2R,3S)-2-(2,6-dichlorophenyl)-5-oxo-3,5-diphenylpentanenitrile (PubChem CID 980020) has the molecular formula C23H17Cl2NO and a molecular weight of 394.30 g/mol. Its IUPAC name is (2R,3S)-2-(2,6-dichlorophenyl)-5-oxo-3,5-diphenylpentanenitrile.
| Compound Name | (2R,3S)-2-(2,6-dichlorophenyl)-5-oxo-3,5-diphenylpentanenitrile |
|---|---|
| PubChem CID | 980020 |
| Molecular Formula | C23H17Cl2NO |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (2R,3S)-2-(2,6-dichlorophenyl)-5-oxo-3,5-diphenylpentanenitrile |
| SMILES | N#C[C@@H](c1c(Cl)cccc1Cl)[C@H](CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H17Cl2NO/c24-20-12-7-13-21(25)23(20)19(15-26)18(16-8-3-1-4-9-16)14-22(27)17-10-5-2-6-11-17/h1-13,18-19H,14H2/t18-,19-/m1/s1 |
| InChIKey | GJUKEXQFCDFTSI-RTBURBONSA-N |
| XLogP | 6.66 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |