C20H19NO — CID 101229631
(Z,4R,5R)-4-methyl-7-oxo-5,7-diphenylhept-2-enenitrile (PubChem CID 101229631) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (Z,4R,5R)-4-methyl-7-oxo-5,7-diphenylhept-2-enenitrile.
| Compound Name | (Z,4R,5R)-4-methyl-7-oxo-5,7-diphenylhept-2-enenitrile |
|---|---|
| PubChem CID | 101229631 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (Z,4R,5R)-4-methyl-7-oxo-5,7-diphenylhept-2-enenitrile |
| SMILES | C[C@H](/C=C\C#N)[C@@H](CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19NO/c1-16(9-8-14-21)19(17-10-4-2-5-11-17)15-20(22)18-12-6-3-7-13-18/h2-13,16,19H,15H2,1H3/b9-8-/t16-,19-/m1/s1 |
| InChIKey | AMMZKSJSKOKDFQ-BUFKOALHSA-N |
| XLogP | 4.76 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|