C19H22OSe2 — CID 13053440
4,4-bis(methylselanyl)-1,3-diphenylpentan-1-one (PubChem CID 13053440) has the molecular formula C19H22OSe2 and a molecular weight of 424.30 g/mol. Its IUPAC name is 4,4-bis(methylselanyl)-1,3-diphenylpentan-1-one.
| Compound Name | 4,4-bis(methylselanyl)-1,3-diphenylpentan-1-one |
|---|---|
| PubChem CID | 13053440 |
| Molecular Formula | C19H22OSe2 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 4,4-bis(methylselanyl)-1,3-diphenylpentan-1-one |
| SMILES | C[Se]C(C)([Se]C)C(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22OSe2/c1-19(21-2,22-3)17(15-10-6-4-7-11-15)14-18(20)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3 |
| InChIKey | PIRIBXXQKZEEOD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|