C22H24N2O3 — CID 23247637
methyl (3S,4S)-3-cyano-6-(dimethylamino)-6-oxo-3,4-diphenylhexanoate (PubChem CID 23247637) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is methyl (3S,4S)-3-cyano-6-(dimethylamino)-6-oxo-3,4-diphenylhexanoate.
| Compound Name | methyl (3S,4S)-3-cyano-6-(dimethylamino)-6-oxo-3,4-diphenylhexanoate |
|---|---|
| PubChem CID | 23247637 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | methyl (3S,4S)-3-cyano-6-(dimethylamino)-6-oxo-3,4-diphenylhexanoate |
| SMILES | COC(=O)C[C@@](C#N)(c1ccccc1)[C@@H](CC(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c1-24(2)20(25)14-19(17-10-6-4-7-11-17)22(16-23,15-21(26)27-3)18-12-8-5-9-13-18/h4-13,19H,14-15H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | UEQQKYCLYUXOHM-SIKLNZKXSA-N |
| XLogP | 3.27 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |