C23H27NO2 — CID 101165093
tert-butyl (3R,4S)-4-cyano-3,4-diphenylhexanoate (PubChem CID 101165093) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-cyano-3,4-diphenylhexanoate.
| Compound Name | tert-butyl (3R,4S)-4-cyano-3,4-diphenylhexanoate |
|---|---|
| PubChem CID | 101165093 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl (3R,4S)-4-cyano-3,4-diphenylhexanoate |
| SMILES | CC[C@@](C#N)(c1ccccc1)[C@H](CC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H27NO2/c1-5-23(17-24,19-14-10-7-11-15-19)20(18-12-8-6-9-13-18)16-21(25)26-22(2,3)4/h6-15,20H,5,16H2,1-4H3/t20-,23-/m1/s1 |
| InChIKey | YPRSEJHKCCMOGJ-NFBKMPQASA-N |
| XLogP | 5.37 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |