About Se-methyl 2-cyano-2-phenylpropaneselenoate
Se-methyl 2-cyano-2-phenylpropaneselenoate (PubChem CID 15778728) has the molecular formula C11H11NOSe
and a molecular weight of 252.18 g/mol. Its IUPAC name is Se-methyl 2-cyano-2-phenylpropaneselenoate.
Molecular Properties
| Compound Name | Se-methyl 2-cyano-2-phenylpropaneselenoate |
| PubChem CID | 15778728 |
| Molecular Formula | C11H11NOSe |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | Se-methyl 2-cyano-2-phenylpropaneselenoate |
| SMILES | C[Se]C(=O)C(C)(C#N)c1ccccc1 |
| InChI | InChI=1S/C11H11NOSe/c1-11(8-12,10(13)14-2)9-6-4-3-5-7-9/h3-7H,1-2H3 |
| InChIKey | FNHIBMJPWZCASL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Se-methyl 2-cyano-2-phenylpropaneselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Se-methyl 2-cyano-2-phenylpropaneselenoate?
The IUPAC name of Se-methyl 2-cyano-2-phenylpropaneselenoate (CID 15778728) is Se-methyl 2-cyano-2-phenylpropaneselenoate.
What is the SMILES notation for Se-methyl 2-cyano-2-phenylpropaneselenoate?
The canonical SMILES for Se-methyl 2-cyano-2-phenylpropaneselenoate is C[Se]C(=O)C(C)(C#N)c1ccccc1.
What is the InChIKey of Se-methyl 2-cyano-2-phenylpropaneselenoate?
The InChIKey is FNHIBMJPWZCASL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOSe/c1-11(8-12,10(13)14-2)9-6-4-3-5-7-9/h3-7H,1-2H3.
What are the key properties of Se-methyl 2-cyano-2-phenylpropaneselenoate?
Se-methyl 2-cyano-2-phenylpropaneselenoate has a molecular weight of 252.18 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Se-methyl 2-cyano-2-phenylpropaneselenoate is sourced from PubChem (CID 15778728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).