C17H11ClN4O2S — CID 151692836
6-chloro-N-[5-cyano-4-(2-methoxyphenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide (PubChem CID 151692836) has the molecular formula C17H11ClN4O2S and a molecular weight of 370.82 g/mol. Its IUPAC name is 6-chloro-N-[5-cyano-4-(2-methoxyphenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[5-cyano-4-(2-methoxyphenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 151692836 |
| Molecular Formula | C17H11ClN4O2S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 6-chloro-N-[5-cyano-4-(2-methoxyphenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
| SMILES | COc1ccccc1-c1nc(NC(=O)c2ccc(Cl)nc2)sc1C#N |
| InChI | InChI=1S/C17H11ClN4O2S/c1-24-12-5-3-2-4-11(12)15-13(8-19)25-17(21-15)22-16(23)10-6-7-14(18)20-9-10/h2-7,9H,1H3,(H,21,22,23) |
| InChIKey | RCYCCIWIGRDCSO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|