About CID 151703747
CID 151703747 (PubChem CID 151703747) has the molecular formula C18H30OSi
and a molecular weight of 290.52 g/mol.
Molecular Properties
| Compound Name | CID 151703747 |
| PubChem CID | 151703747 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)COc1ccccc1C[Si]CCC |
| InChI | InChI=1S/C18H30OSi/c1-4-7-10-16(6-3)14-19-18-12-9-8-11-17(18)15-20-13-5-2/h8-9,11-12,16H,4-7,10,13-15H2,1-3H3 |
| InChIKey | TZBFHPNNGTZYOB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 151703747 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 151703747?
The IUPAC name of CID 151703747 (CID 151703747) is not available.
What is the SMILES notation for CID 151703747?
The canonical SMILES for CID 151703747 is CCCCC(CC)COc1ccccc1C[Si]CCC.
What is the InChIKey of CID 151703747?
The InChIKey is TZBFHPNNGTZYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30OSi/c1-4-7-10-16(6-3)14-19-18-12-9-8-11-17(18)15-20-13-5-2/h8-9,11-12,16H,4-7,10,13-15H2,1-3H3.
What are the key properties of CID 151703747?
CID 151703747 has a molecular weight of 290.52 g/mol, XLogP of 5.31, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 151703747 is sourced from PubChem (CID 151703747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).