C17H24O2Si — CID 174953188
CID 174953188 (PubChem CID 174953188) has the molecular formula C17H24O2Si and a molecular weight of 288.46 g/mol.
| Compound Name | CID 174953188 |
|---|---|
| PubChem CID | 174953188 |
| Molecular Formula | C17H24O2Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | — |
| SMILES | C=C[Si]C(=O)c1ccccc1OCC(CC)CCCC |
| InChI | InChI=1S/C17H24O2Si/c1-4-7-10-14(5-2)13-19-16-12-9-8-11-15(16)17(18)20-6-3/h6,8-9,11-12,14H,3-5,7,10,13H2,1-2H3 |
| InChIKey | VJYKGNWXTVSFOI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|