C13H12FNO — CID 15171317
3-(4-fluorophenyl)-2,6-dimethyl-1H-pyridin-4-one (PubChem CID 15171317) has the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,6-dimethyl-1H-pyridin-4-one.
| Compound Name | 3-(4-fluorophenyl)-2,6-dimethyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 15171317 |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(4-fluorophenyl)-2,6-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1cc(=O)c(-c2ccc(F)cc2)c(C)[nH]1 |
| InChI | InChI=1S/C13H12FNO/c1-8-7-12(16)13(9(2)15-8)10-3-5-11(14)6-4-10/h3-7H,1-2H3,(H,15,16) |
| InChIKey | NXBLMNUAHXGZMA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |