About 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide
5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide (PubChem CID 151721531) has the molecular formula C6H9IN2OS
and a molecular weight of 284.12 g/mol. Its IUPAC name is 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide |
| PubChem CID | 151721531 |
| Molecular Formula | C6H9IN2OS |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide |
| SMILES | CN(C)C(=O)N1C=C(I)SC1 |
| InChI | InChI=1S/C6H9IN2OS/c1-8(2)6(10)9-3-5(7)11-4-9/h3H,4H2,1-2H3 |
| InChIKey | RIRKXHBBEYDIIL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide?
The IUPAC name of 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide (CID 151721531) is 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide.
What is the SMILES notation for 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide?
The canonical SMILES for 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide is CN(C)C(=O)N1C=C(I)SC1.
What is the InChIKey of 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide?
The InChIKey is RIRKXHBBEYDIIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IN2OS/c1-8(2)6(10)9-3-5(7)11-4-9/h3H,4H2,1-2H3.
What are the key properties of 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide?
5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide has a molecular weight of 284.12 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N,N-dimethyl-2H-1,3-thiazole-3-carboxamide is sourced from PubChem (CID 151721531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).