C6H10N2OS — CID 154261691
N,N-dimethyl-2H-1,3-thiazole-3-carboxamide (PubChem CID 154261691) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is N,N-dimethyl-2H-1,3-thiazole-3-carboxamide.
| Compound Name | N,N-dimethyl-2H-1,3-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 154261691 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | N,N-dimethyl-2H-1,3-thiazole-3-carboxamide |
| SMILES | CN(C)C(=O)N1C=CSC1 |
| InChI | InChI=1S/C6H10N2OS/c1-7(2)6(9)8-3-4-10-5-8/h3-4H,5H2,1-2H3 |
| InChIKey | HFYYNJQKRYEWRC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |