C12H15N5O3S — CID 15172878
(2R,3S,5R)-5-(2-amino-6-methylsulfanylpurin-9-yl)-2-(hydroxymethyl)-4-methylideneoxolan-3-ol (PubChem CID 15172878) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is (2R,3S,5R)-5-(2-amino-6-methylsulfanylpurin-9-yl)-2-(hydroxymethyl)-4-methylideneoxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(2-amino-6-methylsulfanylpurin-9-yl)-2-(hydroxymethyl)-4-methylideneoxolan-3-ol |
|---|---|
| PubChem CID | 15172878 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (2R,3S,5R)-5-(2-amino-6-methylsulfanylpurin-9-yl)-2-(hydroxymethyl)-4-methylideneoxolan-3-ol |
| SMILES | C=C1[C@H](n2cnc3c(SC)nc(N)nc32)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C12H15N5O3S/c1-5-8(19)6(3-18)20-11(5)17-4-14-7-9(17)15-12(13)16-10(7)21-2/h4,6,8,11,18-19H,1,3H2,2H3,(H2,13,15,16)/t6-,8+,11-/m1/s1 |
| InChIKey | UXAYQTWSHMMQBL-CDOJRTKCSA-N |
| XLogP | -0.06 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|