C21H30N6O4 — CID 151733256
2-[2-[(2,2-dihydroxyethylamino)-ethylamino]-3-ethoxyphenyl]-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 151733256) has the molecular formula C21H30N6O4 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[2-[(2,2-dihydroxyethylamino)-ethylamino]-3-ethoxyphenyl]-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[2-[(2,2-dihydroxyethylamino)-ethylamino]-3-ethoxyphenyl]-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 151733256 |
| Molecular Formula | C21H30N6O4 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-[2-[(2,2-dihydroxyethylamino)-ethylamino]-3-ethoxyphenyl]-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CCCc1nc(C)c2c(=O)[nH]c(-c3cccc(OCC)c3N(CC)NCC(O)O)nn12 |
| InChI | InChI=1S/C21H30N6O4/c1-5-9-16-23-13(4)18-21(30)24-20(25-27(16)18)14-10-8-11-15(31-7-3)19(14)26(6-2)22-12-17(28)29/h8,10-11,17,22,28-29H,5-7,9,12H2,1-4H3,(H,24,25,30) |
| InChIKey | RKZRUAPXOUMBCW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|