C8H13BrMg — CID 15173349
magnesium;(2E,5E)-octa-2,5-diene;bromide (PubChem CID 15173349) has the molecular formula C8H13BrMg and a molecular weight of 213.40 g/mol. Its IUPAC name is magnesium;(2E,5E)-octa-2,5-diene;bromide.
| Compound Name | magnesium;(2E,5E)-octa-2,5-diene;bromide |
|---|---|
| PubChem CID | 15173349 |
| Molecular Formula | C8H13BrMg |
| Molecular Weight | 213.40 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | magnesium;(2E,5E)-octa-2,5-diene;bromide |
| SMILES | [Br-].[CH2-]C/C=C/C/C=C/C.[Mg+2] |
| InChI | InChI=1S/C8H13.BrH.Mg/c1-3-5-7-8-6-4-2;;/h4-7H,1,3,8H2,2H3;1H;/q-1;;+2/p-1/b6-4+,7-5+;; |
| InChIKey | IUHJRTZCKVFLBF-FNRGTACISA-M |
| XLogP | -0.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|